C19H17NO — CID 135073383
(E)-N-(1,3-diphenylprop-2-ynoxy)-2-methylprop-2-en-1-imine (PubChem CID 135073383) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-N-(1,3-diphenylprop-2-ynoxy)-2-methylprop-2-en-1-imine.
| Compound Name | (E)-N-(1,3-diphenylprop-2-ynoxy)-2-methylprop-2-en-1-imine |
|---|---|
| PubChem CID | 135073383 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (E)-N-(1,3-diphenylprop-2-ynoxy)-2-methylprop-2-en-1-imine |
| SMILES | C=C(C)/C=N/OC(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17NO/c1-16(2)15-20-21-19(18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-12,15,19H,1H2,2H3/b20-15+ |
| InChIKey | QZUWMIKPRTWTIJ-HMMYKYKNSA-N |
| XLogP | 4.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|