C13H15N — CID 11206216
N,N-dimethyl-5-phenylpent-1-en-4-yn-3-amine (PubChem CID 11206216) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N-dimethyl-5-phenylpent-1-en-4-yn-3-amine.
| Compound Name | N,N-dimethyl-5-phenylpent-1-en-4-yn-3-amine |
|---|---|
| PubChem CID | 11206216 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N,N-dimethyl-5-phenylpent-1-en-4-yn-3-amine |
| SMILES | C=CC(C#Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C13H15N/c1-4-13(14(2)3)11-10-12-8-6-5-7-9-12/h4-9,13H,1H2,2-3H3 |
| InChIKey | NELDPYVJFQLBSB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|