C19H19N — CID 54579274
N-methyl-1,3-diphenyl-N-prop-2-enylprop-2-yn-1-amine (PubChem CID 54579274) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is N-methyl-1,3-diphenyl-N-prop-2-enylprop-2-yn-1-amine.
| Compound Name | N-methyl-1,3-diphenyl-N-prop-2-enylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 54579274 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-methyl-1,3-diphenyl-N-prop-2-enylprop-2-yn-1-amine |
| SMILES | C=CCN(C)C(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N/c1-3-16-20(2)19(18-12-8-5-9-13-18)15-14-17-10-6-4-7-11-17/h3-13,19H,1,16H2,2H3 |
| InChIKey | FVRDUOHTWKXIKA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|