C16H20O — CID 10977247
(4,4-dimethyl-3-prop-2-enoxypent-1-ynyl)benzene (PubChem CID 10977247) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (4,4-dimethyl-3-prop-2-enoxypent-1-ynyl)benzene.
| Compound Name | (4,4-dimethyl-3-prop-2-enoxypent-1-ynyl)benzene |
|---|---|
| PubChem CID | 10977247 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (4,4-dimethyl-3-prop-2-enoxypent-1-ynyl)benzene |
| SMILES | C=CCOC(C#Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H20O/c1-5-13-17-15(16(2,3)4)12-11-14-9-7-6-8-10-14/h5-10,15H,1,13H2,2-4H3 |
| InChIKey | BNFZOPZXCLJIHL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|