C18H24O2 — CID 101073803
[5-(ethoxymethoxy)-4,4-dimethylhept-6-en-1-ynyl]benzene (PubChem CID 101073803) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is [5-(ethoxymethoxy)-4,4-dimethylhept-6-en-1-ynyl]benzene.
| Compound Name | [5-(ethoxymethoxy)-4,4-dimethylhept-6-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 101073803 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [5-(ethoxymethoxy)-4,4-dimethylhept-6-en-1-ynyl]benzene |
| SMILES | C=CC(OCOCC)C(C)(C)CC#Cc1ccccc1 |
| InChI | InChI=1S/C18H24O2/c1-5-17(20-15-19-6-2)18(3,4)14-10-13-16-11-8-7-9-12-16/h5,7-9,11-12,17H,1,6,14-15H2,2-4H3 |
| InChIKey | TXUTZRHZYIGQJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|