C23H16F3NO — CID 134836998
(Z)-N-[(1R)-1,3-diphenylprop-2-ynoxy]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 134836998) has the molecular formula C23H16F3NO and a molecular weight of 379.38 g/mol. Its IUPAC name is (Z)-N-[(1R)-1,3-diphenylprop-2-ynoxy]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | (Z)-N-[(1R)-1,3-diphenylprop-2-ynoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 134836998 |
| Molecular Formula | C23H16F3NO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (Z)-N-[(1R)-1,3-diphenylprop-2-ynoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(/C=N\O[C@@H](C#Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16F3NO/c24-23(25,26)21-14-11-19(12-15-21)17-27-28-22(20-9-5-2-6-10-20)16-13-18-7-3-1-4-8-18/h1-12,14-15,17,22H/b27-17-/t22-/m0/s1 |
| InChIKey | AQIDOYAPNPAGGJ-NWUVQHAMSA-N |
| XLogP | 5.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|