C11H12N4O2 — CID 104500912
2-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid (PubChem CID 104500912) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid.
| Compound Name | 2-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 104500912 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid |
| SMILES | Cc1nc(C)n(-c2ccc(C(=O)O)c(N)c2)n1 |
| InChI | InChI=1S/C11H12N4O2/c1-6-13-7(2)15(14-6)8-3-4-9(11(16)17)10(12)5-8/h3-5H,12H2,1-2H3,(H,16,17) |
| InChIKey | FNUXPTAPRKNRLF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|