C16H17NO4 — CID 104501841
3-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]butanoic acid (PubChem CID 104501841) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]butanoic acid.
| Compound Name | 3-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 104501841 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]butanoic acid |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-10-7-8-21-15(10)16(20)17-13-5-3-12(4-6-13)11(2)9-14(18)19/h3-8,11H,9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | GMTULDXUJBRGLS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |