C15H14FNO4 — CID 84583373
3-(4-fluorophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 84583373) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 84583373 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-(4-fluorophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1ccoc1C(=O)NC(CC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FNO4/c1-9-6-7-21-14(9)15(20)17-12(8-13(18)19)10-2-4-11(16)5-3-10/h2-7,12H,8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | KRVWUHPLFPYKEU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |