C15H14BrNO4 — CID 97233805
(3R)-3-(3-bromophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 97233805) has the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. Its IUPAC name is (3R)-3-(3-bromophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (3R)-3-(3-bromophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 97233805 |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (3R)-3-(3-bromophenyl)-3-[(3-methylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1ccoc1C(=O)N[C@H](CC(=O)O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H14BrNO4/c1-9-5-6-21-14(9)15(20)17-12(8-13(18)19)10-3-2-4-11(16)7-10/h2-7,12H,8H2,1H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | SAIOHMSHAPMMCN-GFCCVEGCSA-N |
| XLogP | 3.30 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |