C16H17NO4 — CID 104501883
3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenyl]butanoic acid (PubChem CID 104501883) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenyl]butanoic acid.
| Compound Name | 3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 104501883 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
| SMILES | CC1=C(C)C(=O)N(c2ccc(C(C)CC(=O)O)cc2)C1=O |
| InChI | InChI=1S/C16H17NO4/c1-9(8-14(18)19)12-4-6-13(7-5-12)17-15(20)10(2)11(3)16(17)21/h4-7,9H,8H2,1-3H3,(H,18,19) |
| InChIKey | BZPSMXCSSBPWNH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|