About 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid
3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid (PubChem CID 83836470) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid |
| PubChem CID | 83836470 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid |
| SMILES | Cc1ncc2ccc(C(C)CC(=O)O)cn12 |
| InChI | InChI=1S/C12H14N2O2/c1-8(5-12(15)16)10-3-4-11-6-13-9(2)14(11)7-10/h3-4,6-8H,5H2,1-2H3,(H,15,16) |
| InChIKey | OLIMUEWTYNDEEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid?
The IUPAC name of 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid (CID 83836470) is 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid.
What is the SMILES notation for 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid?
The canonical SMILES for 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid is Cc1ncc2ccc(C(C)CC(=O)O)cn12.
What is the InChIKey of 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid?
The InChIKey is OLIMUEWTYNDEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-8(5-12(15)16)10-3-4-11-6-13-9(2)14(11)7-10/h3-4,6-8H,5H2,1-2H3,(H,15,16).
What are the key properties of 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid?
3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid has a molecular weight of 218.26 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylimidazo[1,5-a]pyridin-6-yl)butanoic acid is sourced from PubChem (CID 83836470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).