C12H14N2O2 — CID 83836461
3-(5-methylimidazo[1,5-a]pyridin-1-yl)butanoic acid (PubChem CID 83836461) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(5-methylimidazo[1,5-a]pyridin-1-yl)butanoic acid.
| Compound Name | 3-(5-methylimidazo[1,5-a]pyridin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 83836461 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(5-methylimidazo[1,5-a]pyridin-1-yl)butanoic acid |
| SMILES | Cc1cccc2c(C(C)CC(=O)O)ncn12 |
| InChI | InChI=1S/C12H14N2O2/c1-8(6-11(15)16)12-10-5-3-4-9(2)14(10)7-13-12/h3-5,7-8H,6H2,1-2H3,(H,15,16) |
| InChIKey | PDHXOLZLVWGFCP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |