3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid

C10H11N3O2 — CID 116989392

IUPAC3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid
SMILESCC(CC(=O)O)c1nc2ccccn2n1
InChIInChI=1S/C10H11N3O2/c1-7(6-9(14)15)10-11-8-4-2-3-5-13(8)12-10/h2-5,7H,6H2,1H3,(H,14,15)
InChIKeyWRHKJTPNOJWQEU-UHFFFAOYSA-N
MW205.22 g/mol
LogP1.31
Rot. Bonds3

About 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid

3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid (PubChem CID 116989392) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid.

Molecular Properties

Compound Name3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid
PubChem CID116989392
Molecular FormulaC10H11N3O2
Molecular Weight205.22 g/mol
Exact Mass205.09
IUPAC Name3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid
SMILESCC(CC(=O)O)c1nc2ccccn2n1
InChIInChI=1S/C10H11N3O2/c1-7(6-9(14)15)10-11-8-4-2-3-5-13(8)12-10/h2-5,7H,6H2,1H3,(H,14,15)
InChIKeyWRHKJTPNOJWQEU-UHFFFAOYSA-N
XLogP1.31
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.22
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid?
The IUPAC name of 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid (CID 116989392) is 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid.
What is the SMILES notation for 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid?
The canonical SMILES for 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid is CC(CC(=O)O)c1nc2ccccn2n1.
What is the InChIKey of 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid?
The InChIKey is WRHKJTPNOJWQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-7(6-9(14)15)10-11-8-4-2-3-5-13(8)12-10/h2-5,7H,6H2,1H3,(H,14,15).
What are the key properties of 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid?
3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid has a molecular weight of 205.22 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1,2,4]triazolo[1,5-a]pyridin-2-yl)butanoic acid is sourced from PubChem (CID 116989392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).