About 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine
2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine (PubChem CID 116989368) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine.
Analyze 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine?
The IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine (CID 116989368) is 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine.
What is the SMILES notation for 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine?
The canonical SMILES for 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine is CC(CN)c1nc2ccccn2n1.
What is the InChIKey of 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine?
The InChIKey is RYTNNHGOJQSMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-7(6-10)9-11-8-4-2-3-5-13(8)12-9/h2-5,7H,6,10H2,1H3.
What are the key properties of 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine?
2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine has a molecular weight of 176.22 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine is sourced from PubChem (CID 116989368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).