C11H11ClN2O2 — CID 83842810
3-(3-chloroimidazo[1,5-a]pyridin-7-yl)butanoic acid (PubChem CID 83842810) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 3-(3-chloroimidazo[1,5-a]pyridin-7-yl)butanoic acid.
| Compound Name | 3-(3-chloroimidazo[1,5-a]pyridin-7-yl)butanoic acid |
|---|---|
| PubChem CID | 83842810 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-(3-chloroimidazo[1,5-a]pyridin-7-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1ccn2c(Cl)ncc2c1 |
| InChI | InChI=1S/C11H11ClN2O2/c1-7(4-10(15)16)8-2-3-14-9(5-8)6-13-11(14)12/h2-3,5-7H,4H2,1H3,(H,15,16) |
| InChIKey | PGAQOSIYAJZSNP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |