C20H16N2O4 — CID 10450406
5-ethyl-5,16-dihydroxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione (PubChem CID 10450406) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 5-ethyl-5,16-dihydroxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione.
| Compound Name | 5-ethyl-5,16-dihydroxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione |
|---|---|
| PubChem CID | 10450406 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-ethyl-5,16-dihydroxy-10,20-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(12),2,4(8),13,15,17,19-heptaene-6,9-dione |
| SMILES | CCC1(O)C(=O)Cc2c1cc1n(c2=O)Cc2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C20H16N2O4/c1-2-20(26)14-8-16-18-11(5-10-6-12(23)3-4-15(10)21-18)9-22(16)19(25)13(14)7-17(20)24/h3-6,8,23,26H,2,7,9H2,1H3 |
| InChIKey | KTIRBUGSEJOKOQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |