C17H16BrN3 — CID 104504152
N-(3-bromophenyl)-1-isoquinolin-4-ylethane-1,2-diamine (PubChem CID 104504152) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-isoquinolin-4-ylethane-1,2-diamine.
| Compound Name | N-(3-bromophenyl)-1-isoquinolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 104504152 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-(3-bromophenyl)-1-isoquinolin-4-ylethane-1,2-diamine |
| SMILES | NCC(Nc1cccc(Br)c1)c1cncc2ccccc12 |
| InChI | InChI=1S/C17H16BrN3/c18-13-5-3-6-14(8-13)21-17(9-19)16-11-20-10-12-4-1-2-7-15(12)16/h1-8,10-11,17,21H,9,19H2 |
| InChIKey | BCXJFVZLSIKTIV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |