C12H12Br2N2O — CID 65377477
1-(5-bromofuran-2-yl)-N-(3-bromophenyl)ethane-1,2-diamine (PubChem CID 65377477) has the molecular formula C12H12Br2N2O and a molecular weight of 360.05 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-N-(3-bromophenyl)ethane-1,2-diamine.
| Compound Name | 1-(5-bromofuran-2-yl)-N-(3-bromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65377477 |
| Molecular Formula | C12H12Br2N2O |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-N-(3-bromophenyl)ethane-1,2-diamine |
| SMILES | NCC(Nc1cccc(Br)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H12Br2N2O/c13-8-2-1-3-9(6-8)16-10(7-15)11-4-5-12(14)17-11/h1-6,10,16H,7,15H2 |
| InChIKey | WLJFOIIEEJKRRJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |