C13H15BrN2O — CID 65377791
1-(5-bromofuran-2-yl)-N-(2-methylphenyl)ethane-1,2-diamine (PubChem CID 65377791) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-N-(2-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(5-bromofuran-2-yl)-N-(2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65377791 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-N-(2-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccccc1NC(CN)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H15BrN2O/c1-9-4-2-3-5-10(9)16-11(8-15)12-6-7-13(14)17-12/h2-7,11,16H,8,15H2,1H3 |
| InChIKey | CPRBZIRKDTVLGK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |