C15H16F2N2 — CID 65378631
1-(2,3-difluorophenyl)-N-(2-methylphenyl)ethane-1,2-diamine (PubChem CID 65378631) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-(2-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,3-difluorophenyl)-N-(2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65378631 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-(2-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccccc1NC(CN)c1cccc(F)c1F |
| InChI | InChI=1S/C15H16F2N2/c1-10-5-2-3-8-13(10)19-14(9-18)11-6-4-7-12(16)15(11)17/h2-8,14,19H,9,18H2,1H3 |
| InChIKey | FHNTWPXZOPJGME-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |