C21H23N3O2 — CID 10450489
6-[2-(1-benzylpiperidin-4-yl)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 10450489) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 6-[2-(1-benzylpiperidin-4-yl)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[2-(1-benzylpiperidin-4-yl)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 10450489 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 6-[2-(1-benzylpiperidin-4-yl)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1CCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3O2/c25-20-18-7-4-11-22-19(18)21(26)24(20)14-10-16-8-12-23(13-9-16)15-17-5-2-1-3-6-17/h1-7,11,16H,8-10,12-15H2 |
| InChIKey | LORWXMAHQNWARL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|