C15H17N3O — CID 104505155
4-amino-1-ethyl-5-isoquinolin-4-ylpyrrolidin-2-one (PubChem CID 104505155) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-amino-1-ethyl-5-isoquinolin-4-ylpyrrolidin-2-one.
| Compound Name | 4-amino-1-ethyl-5-isoquinolin-4-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104505155 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-amino-1-ethyl-5-isoquinolin-4-ylpyrrolidin-2-one |
| SMILES | CCN1C(=O)CC(N)C1c1cncc2ccccc12 |
| InChI | InChI=1S/C15H17N3O/c1-2-18-14(19)7-13(16)15(18)12-9-17-8-10-5-3-4-6-11(10)12/h3-6,8-9,13,15H,2,7,16H2,1H3 |
| InChIKey | GFUOIMQPRPQEQW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |