C17H23N3 — CID 104505167
2-isoquinolin-4-yl-1-propylpiperidin-3-amine (PubChem CID 104505167) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-isoquinolin-4-yl-1-propylpiperidin-3-amine.
| Compound Name | 2-isoquinolin-4-yl-1-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 104505167 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-isoquinolin-4-yl-1-propylpiperidin-3-amine |
| SMILES | CCCN1CCCC(N)C1c1cncc2ccccc12 |
| InChI | InChI=1S/C17H23N3/c1-2-9-20-10-5-8-16(18)17(20)15-12-19-11-13-6-3-4-7-14(13)15/h3-4,6-7,11-12,16-17H,2,5,8-10,18H2,1H3 |
| InChIKey | PYCKAQXDJKPNHR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |