C13H18ClFN2 — CID 114488962
2-(3-chloro-2-fluorophenyl)-1-propylpyrrolidin-3-amine (PubChem CID 114488962) has the molecular formula C13H18ClFN2 and a molecular weight of 256.75 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-propylpyrrolidin-3-amine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 114488962 |
| Molecular Formula | C13H18ClFN2 |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-propylpyrrolidin-3-amine |
| SMILES | CCCN1CCC(N)C1c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H18ClFN2/c1-2-7-17-8-6-11(16)13(17)9-4-3-5-10(14)12(9)15/h3-5,11,13H,2,6-8,16H2,1H3 |
| InChIKey | OZWSHTSBCPERSU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |