C22H42OSi — CID 10450559
tert-butyl-dimethyl-[[(1R,2R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]nonanyl]oxy]silane (PubChem CID 10450559) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]nonanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]nonanyl]oxy]silane |
|---|---|
| PubChem CID | 10450559 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,6S,7R)-6,7,9,9-tetramethyl-7-prop-2-enyl-2-bicyclo[4.2.1]nonanyl]oxy]silane |
| SMILES | C=CC[C@]1(C)C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C22H42OSi/c1-11-14-21(7)16-17-18(23-24(9,10)19(2,3)4)13-12-15-22(21,8)20(17,5)6/h11,17-18H,1,12-16H2,2-10H3/t17-,18+,21+,22+/m0/s1 |
| InChIKey | HWYUNWWGKPQMQX-XHIHJMKYSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|