C20H19NO5 — CID 10450713
(1S,2R,9R)-2,12-dihydroxy-5,18-dimethyl-6,10-dioxa-18-azahexacyclo[9.9.1.01,9.02,17.03,7.015,21]henicosa-3(7),4,11,13,15(21)-pentaen-8-one (PubChem CID 10450713) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (1S,2R,9R)-2,12-dihydroxy-5,18-dimethyl-6,10-dioxa-18-azahexacyclo[9.9.1.01,9.02,17.03,7.015,21]henicosa-3(7),4,11,13,15(21)-pentaen-8-one.
| Compound Name | (1S,2R,9R)-2,12-dihydroxy-5,18-dimethyl-6,10-dioxa-18-azahexacyclo[9.9.1.01,9.02,17.03,7.015,21]henicosa-3(7),4,11,13,15(21)-pentaen-8-one |
|---|---|
| PubChem CID | 10450713 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (1S,2R,9R)-2,12-dihydroxy-5,18-dimethyl-6,10-dioxa-18-azahexacyclo[9.9.1.01,9.02,17.03,7.015,21]henicosa-3(7),4,11,13,15(21)-pentaen-8-one |
| SMILES | Cc1cc2c(o1)C(=O)[C@@H]1Oc3c(O)ccc4c3[C@@]13CCN(C)C(C4)[C@]23O |
| InChI | InChI=1S/C20H19NO5/c1-9-7-11-16(25-9)15(23)18-19-5-6-21(2)13(20(11,19)24)8-10-3-4-12(22)17(26-18)14(10)19/h3-4,7,13,18,22,24H,5-6,8H2,1-2H3/t13?,18-,19-,20+/m0/s1 |
| InChIKey | FOHAYZOHIKATGL-GQXZWLEESA-N |
| XLogP | 1.64 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |