C25H21NO4 — CID 58782592
(1S,2S,14R)-2,17-dihydroxy-23-methyl-15-oxa-23-azaheptacyclo[14.9.1.01,14.02,22.03,12.05,10.020,26]hexacosa-3,5,7,9,11,16,18,20(26)-octaen-13-one (PubChem CID 58782592) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (1S,2S,14R)-2,17-dihydroxy-23-methyl-15-oxa-23-azaheptacyclo[14.9.1.01,14.02,22.03,12.05,10.020,26]hexacosa-3,5,7,9,11,16,18,20(26)-octaen-13-one.
| Compound Name | (1S,2S,14R)-2,17-dihydroxy-23-methyl-15-oxa-23-azaheptacyclo[14.9.1.01,14.02,22.03,12.05,10.020,26]hexacosa-3,5,7,9,11,16,18,20(26)-octaen-13-one |
|---|---|
| PubChem CID | 58782592 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (1S,2S,14R)-2,17-dihydroxy-23-methyl-15-oxa-23-azaheptacyclo[14.9.1.01,14.02,22.03,12.05,10.020,26]hexacosa-3,5,7,9,11,16,18,20(26)-octaen-13-one |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)c2cc4ccccc4cc2[C@@]3(O)C1C5 |
| InChI | InChI=1S/C25H21NO4/c1-26-9-8-24-20-15-6-7-18(27)22(20)30-23(24)21(28)16-10-13-4-2-3-5-14(13)11-17(16)25(24,29)19(26)12-15/h2-7,10-11,19,23,27,29H,8-9,12H2,1H3/t19?,23-,24-,25+/m0/s1 |
| InChIKey | NGVKCYUNWUUEDM-DYZJZLFBSA-N |
| XLogP | 2.89 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |