C18H14BrNO2 — CID 10450887
[(1R,9R,11S)-7-bromo-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4(13),5,7-trien-3-yl]-phenylmethanone (PubChem CID 10450887) has the molecular formula C18H14BrNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is [(1R,9R,11S)-7-bromo-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4(13),5,7-trien-3-yl]-phenylmethanone.
| Compound Name | [(1R,9R,11S)-7-bromo-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4(13),5,7-trien-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10450887 |
| Molecular Formula | C18H14BrNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | [(1R,9R,11S)-7-bromo-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4(13),5,7-trien-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@@H]2C[C@@H]3O[C@@H]3c3c(Br)ccc1c32 |
| InChI | InChI=1S/C18H14BrNO2/c19-12-6-7-13-15-11(8-14-17(22-14)16(12)15)9-20(13)18(21)10-4-2-1-3-5-10/h1-7,11,14,17H,8-9H2/t11-,14-,17-/m0/s1 |
| InChIKey | JACUOVMMZAKJBG-YLVFBTJISA-N |
| XLogP | 4.04 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|