C19H17NO2 — CID 10266284
[(1R,9R,11S)-9-methyl-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4,6,8(13)-trien-3-yl]-phenylmethanone (PubChem CID 10266284) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is [(1R,9R,11S)-9-methyl-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4,6,8(13)-trien-3-yl]-phenylmethanone.
| Compound Name | [(1R,9R,11S)-9-methyl-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4,6,8(13)-trien-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10266284 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [(1R,9R,11S)-9-methyl-10-oxa-3-azatetracyclo[6.4.1.04,13.09,11]trideca-4,6,8(13)-trien-3-yl]-phenylmethanone |
| SMILES | C[C@]12O[C@H]1C[C@H]1CN(C(=O)c3ccccc3)c3cccc2c31 |
| InChI | InChI=1S/C19H17NO2/c1-19-14-8-5-9-15-17(14)13(10-16(19)22-19)11-20(15)18(21)12-6-3-2-4-7-12/h2-9,13,16H,10-11H2,1H3/t13-,16-,19+/m0/s1 |
| InChIKey | MVRHAHYVLVKHOW-IYJAJMOOSA-N |
| XLogP | 3.45 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|