C12H12BrClN2 — CID 104509036
1-(4-bromo-2-methylphenyl)-5-chloro-3,4-dimethylpyrazole (PubChem CID 104509036) has the molecular formula C12H12BrClN2 and a molecular weight of 299.60 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-5-chloro-3,4-dimethylpyrazole.
| Compound Name | 1-(4-bromo-2-methylphenyl)-5-chloro-3,4-dimethylpyrazole |
|---|---|
| PubChem CID | 104509036 |
| Molecular Formula | C12H12BrClN2 |
| Molecular Weight | 299.60 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-5-chloro-3,4-dimethylpyrazole |
| SMILES | Cc1cc(Br)ccc1-n1nc(C)c(C)c1Cl |
| InChI | InChI=1S/C12H12BrClN2/c1-7-6-10(13)4-5-11(7)16-12(14)8(2)9(3)15-16/h4-6H,1-3H3 |
| InChIKey | ZHAITAXIUANDBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |