C13H14BrClN2O — CID 116817882
2-[1-(4-bromo-2-methylphenyl)-5-chloro-3-methylpyrazol-4-yl]ethanol (PubChem CID 116817882) has the molecular formula C13H14BrClN2O and a molecular weight of 329.63 g/mol. Its IUPAC name is 2-[1-(4-bromo-2-methylphenyl)-5-chloro-3-methylpyrazol-4-yl]ethanol.
| Compound Name | 2-[1-(4-bromo-2-methylphenyl)-5-chloro-3-methylpyrazol-4-yl]ethanol |
|---|---|
| PubChem CID | 116817882 |
| Molecular Formula | C13H14BrClN2O |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-[1-(4-bromo-2-methylphenyl)-5-chloro-3-methylpyrazol-4-yl]ethanol |
| SMILES | Cc1cc(Br)ccc1-n1nc(C)c(CCO)c1Cl |
| InChI | InChI=1S/C13H14BrClN2O/c1-8-7-10(14)3-4-12(8)17-13(15)11(5-6-18)9(2)16-17/h3-4,7,18H,5-6H2,1-2H3 |
| InChIKey | OHSROJGSWISBHS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |