C17H20N6OS — CID 10450937
2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylhexanamide (PubChem CID 10450937) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylhexanamide.
| Compound Name | 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylhexanamide |
|---|---|
| PubChem CID | 10450937 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylhexanamide |
| SMILES | CCCCC(Sc1nc(N)c2cnn(-c3ccccc3)c2n1)C(N)=O |
| InChI | InChI=1S/C17H20N6OS/c1-2-3-9-13(15(19)24)25-17-21-14(18)12-10-20-23(16(12)22-17)11-7-5-4-6-8-11/h4-8,10,13H,2-3,9H2,1H3,(H2,19,24)(H2,18,21,22) |
| InChIKey | PLZMNWQRIDASHR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |