C15H26F3NO2 — CID 104509767
N-[[2-cyclopropyl-3-[3-(2,2,2-trifluoroethoxy)propyl]oxolan-3-yl]methyl]ethanamine (PubChem CID 104509767) has the molecular formula C15H26F3NO2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[[2-cyclopropyl-3-[3-(2,2,2-trifluoroethoxy)propyl]oxolan-3-yl]methyl]ethanamine.
| Compound Name | N-[[2-cyclopropyl-3-[3-(2,2,2-trifluoroethoxy)propyl]oxolan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 104509767 |
| Molecular Formula | C15H26F3NO2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[[2-cyclopropyl-3-[3-(2,2,2-trifluoroethoxy)propyl]oxolan-3-yl]methyl]ethanamine |
| SMILES | CCNCC1(CCCOCC(F)(F)F)CCOC1C1CC1 |
| InChI | InChI=1S/C15H26F3NO2/c1-2-19-10-14(6-3-8-20-11-15(16,17)18)7-9-21-13(14)12-4-5-12/h12-13,19H,2-11H2,1H3 |
| InChIKey | IUDNKRIPNYCSQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|