C11H18F3NO2 — CID 104510321
2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-amine (PubChem CID 104510321) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-amine.
| Compound Name | 2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 104510321 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-amine |
| SMILES | NC1(CCOCC(F)(F)F)CCOC1C1CC1 |
| InChI | InChI=1S/C11H18F3NO2/c12-11(13,14)7-16-5-3-10(15)4-6-17-9(10)8-1-2-8/h8-9H,1-7,15H2 |
| InChIKey | AWQHATNMICCITC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|