C9H15F2NO — CID 164655201
2-cyclopropyl-3-(2,2-difluoroethyl)oxolan-3-amine (PubChem CID 164655201) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2,2-difluoroethyl)oxolan-3-amine.
| Compound Name | 2-cyclopropyl-3-(2,2-difluoroethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 164655201 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-cyclopropyl-3-(2,2-difluoroethyl)oxolan-3-amine |
| SMILES | NC1(CC(F)F)CCOC1C1CC1 |
| InChI | InChI=1S/C9H15F2NO/c10-7(11)5-9(12)3-4-13-8(9)6-1-2-6/h6-8H,1-5,12H2 |
| InChIKey | XKIMVZJJCUEBTK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |