C15H19FO2 — CID 104510415
[2-cyclopropyl-3-[(4-fluorophenyl)methyl]oxolan-3-yl]methanol (PubChem CID 104510415) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is [2-cyclopropyl-3-[(4-fluorophenyl)methyl]oxolan-3-yl]methanol.
| Compound Name | [2-cyclopropyl-3-[(4-fluorophenyl)methyl]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 104510415 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [2-cyclopropyl-3-[(4-fluorophenyl)methyl]oxolan-3-yl]methanol |
| SMILES | OCC1(Cc2ccc(F)cc2)CCOC1C1CC1 |
| InChI | InChI=1S/C15H19FO2/c16-13-5-1-11(2-6-13)9-15(10-17)7-8-18-14(15)12-3-4-12/h1-2,5-6,12,14,17H,3-4,7-10H2 |
| InChIKey | TWRCCOUPOMJCJS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |