C11H16N2O4 — CID 104515007
2,2-diethoxy-1-(3-methoxypyrazin-2-yl)ethanone (PubChem CID 104515007) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2,2-diethoxy-1-(3-methoxypyrazin-2-yl)ethanone.
| Compound Name | 2,2-diethoxy-1-(3-methoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 104515007 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2,2-diethoxy-1-(3-methoxypyrazin-2-yl)ethanone |
| SMILES | CCOC(OCC)C(=O)c1nccnc1OC |
| InChI | InChI=1S/C11H16N2O4/c1-4-16-11(17-5-2)9(14)8-10(15-3)13-7-6-12-8/h6-7,11H,4-5H2,1-3H3 |
| InChIKey | INKREJWBCUMZLA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|