C9H10N2O3 — CID 55262325
1-(3-methoxypyrazin-2-yl)butane-1,3-dione (PubChem CID 55262325) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-(3-methoxypyrazin-2-yl)butane-1,3-dione.
| Compound Name | 1-(3-methoxypyrazin-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 55262325 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-(3-methoxypyrazin-2-yl)butane-1,3-dione |
| SMILES | COc1nccnc1C(=O)CC(C)=O |
| InChI | InChI=1S/C9H10N2O3/c1-6(12)5-7(13)8-9(14-2)11-4-3-10-8/h3-4H,5H2,1-2H3 |
| InChIKey | QCMDXWUZEPOQDI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|