C21H20ClNO3 — CID 10451768
6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoic acid (PubChem CID 10451768) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoic acid.
| Compound Name | 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 10451768 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc(-c2ccc(Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C21H20ClNO3/c22-16-11-9-15(10-12-16)18-14-20(23-19-7-4-3-6-17(18)19)26-13-5-1-2-8-21(24)25/h3-4,6-7,9-12,14H,1-2,5,8,13H2,(H,24,25) |
| InChIKey | NJPHOGPVYRFHDQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|