C16H27NO2S — CID 104518885
1-(2,5-diethylphenyl)-N-ethyl-2-methylsulfonylpropan-1-amine (PubChem CID 104518885) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 1-(2,5-diethylphenyl)-N-ethyl-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-(2,5-diethylphenyl)-N-ethyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 104518885 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(2,5-diethylphenyl)-N-ethyl-2-methylsulfonylpropan-1-amine |
| SMILES | CCNC(c1cc(CC)ccc1CC)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C16H27NO2S/c1-6-13-9-10-14(7-2)15(11-13)16(17-8-3)12(4)20(5,18)19/h9-12,16-17H,6-8H2,1-5H3 |
| InChIKey | REVXPTKPTCMZSD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |