C12H11ClFNO3S — CID 104519621
2-(3-chloro-2-fluorophenyl)-4-methylsulfonyl-3-oxopentanenitrile (PubChem CID 104519621) has the molecular formula C12H11ClFNO3S and a molecular weight of 303.74 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-4-methylsulfonyl-3-oxopentanenitrile.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-4-methylsulfonyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 104519621 |
| Molecular Formula | C12H11ClFNO3S |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-4-methylsulfonyl-3-oxopentanenitrile |
| SMILES | CC(C(=O)C(C#N)c1cccc(Cl)c1F)S(C)(=O)=O |
| InChI | InChI=1S/C12H11ClFNO3S/c1-7(19(2,17)18)12(16)9(6-15)8-4-3-5-10(13)11(8)14/h3-5,7,9H,1-2H3 |
| InChIKey | BOMDEEBXUTZIKL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |