C13H13ClFNO3S — CID 82802441
2-(3-chloro-2-fluorophenyl)-4-methyl-4-methylsulfonyl-3-oxopentanenitrile (PubChem CID 82802441) has the molecular formula C13H13ClFNO3S and a molecular weight of 317.77 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-4-methyl-4-methylsulfonyl-3-oxopentanenitrile.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-4-methyl-4-methylsulfonyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 82802441 |
| Molecular Formula | C13H13ClFNO3S |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-4-methyl-4-methylsulfonyl-3-oxopentanenitrile |
| SMILES | CC(C)(C(=O)C(C#N)c1cccc(Cl)c1F)S(C)(=O)=O |
| InChI | InChI=1S/C13H13ClFNO3S/c1-13(2,20(3,18)19)12(17)9(7-16)8-5-4-6-10(14)11(8)15/h4-6,9H,1-3H3 |
| InChIKey | JEFDHGCNMRXWPC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |