C7H13NO4S — CID 104520399
2-methylsulfonyl-1-(1,2-oxazolidin-2-yl)propan-1-one (PubChem CID 104520399) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(1,2-oxazolidin-2-yl)propan-1-one.
| Compound Name | 2-methylsulfonyl-1-(1,2-oxazolidin-2-yl)propan-1-one |
|---|---|
| PubChem CID | 104520399 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-methylsulfonyl-1-(1,2-oxazolidin-2-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C7H13NO4S/c1-6(13(2,10)11)7(9)8-4-3-5-12-8/h6H,3-5H2,1-2H3 |
| InChIKey | GYUXSQHMQVXSMJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |