C14H16BrNO4S — CID 104521589
7-(1-bromo-2-methylsulfonylpropyl)-2-methyl-4H-isoquinoline-1,3-dione (PubChem CID 104521589) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 7-(1-bromo-2-methylsulfonylpropyl)-2-methyl-4H-isoquinoline-1,3-dione.
| Compound Name | 7-(1-bromo-2-methylsulfonylpropyl)-2-methyl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 104521589 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 7-(1-bromo-2-methylsulfonylpropyl)-2-methyl-4H-isoquinoline-1,3-dione |
| SMILES | CC(C(Br)c1ccc2c(c1)C(=O)N(C)C(=O)C2)S(C)(=O)=O |
| InChI | InChI=1S/C14H16BrNO4S/c1-8(21(3,19)20)13(15)10-5-4-9-7-12(17)16(2)14(18)11(9)6-10/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | UAWXSTAYUUGQMV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|