C18H23N3O4S — CID 10452215
methyl 3-cyclohexyl-2-(4-nitrophenyl)imino-1,3-thiazinane-6-carboxylate (PubChem CID 10452215) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-(4-nitrophenyl)imino-1,3-thiazinane-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-2-(4-nitrophenyl)imino-1,3-thiazinane-6-carboxylate |
|---|---|
| PubChem CID | 10452215 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl 3-cyclohexyl-2-(4-nitrophenyl)imino-1,3-thiazinane-6-carboxylate |
| SMILES | COC(=O)C1CCN(C2CCCCC2)/C(=N/c2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C18H23N3O4S/c1-25-17(22)16-11-12-20(14-5-3-2-4-6-14)18(26-16)19-13-7-9-15(10-8-13)21(23)24/h7-10,14,16H,2-6,11-12H2,1H3/b19-18- |
| InChIKey | FZKHTTXGGRXMAQ-HNENSFHCSA-N |
| XLogP | 3.90 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|