C10H18N2O3S — CID 104522638
N-methyl-3-[5-(1-methylsulfonylethyl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 104522638) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-methyl-3-[5-(1-methylsulfonylethyl)-1,3-oxazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(1-methylsulfonylethyl)-1,3-oxazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 104522638 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-methyl-3-[5-(1-methylsulfonylethyl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1ncc(C(C)S(C)(=O)=O)o1 |
| InChI | InChI=1S/C10H18N2O3S/c1-8(16(3,13)14)9-7-12-10(15-9)5-4-6-11-2/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | PHAGJQDWUYHENO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|