C9H16N2O — CID 115087026
N-methyl-1-(2-propyl-1,3-oxazol-5-yl)ethanamine (PubChem CID 115087026) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methyl-1-(2-propyl-1,3-oxazol-5-yl)ethanamine.
| Compound Name | N-methyl-1-(2-propyl-1,3-oxazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 115087026 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-methyl-1-(2-propyl-1,3-oxazol-5-yl)ethanamine |
| SMILES | CCCc1ncc(C(C)NC)o1 |
| InChI | InChI=1S/C9H16N2O/c1-4-5-9-11-6-8(12-9)7(2)10-3/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | HBTDPNMLNSNHOY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |