C13H15N3O3S — CID 104522912
5-(1,1-dioxothian-2-yl)-4-pyridin-2-yl-1,2-oxazol-3-amine (PubChem CID 104522912) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-(1,1-dioxothian-2-yl)-4-pyridin-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(1,1-dioxothian-2-yl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 104522912 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-(1,1-dioxothian-2-yl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C2CCCCS2(=O)=O)c1-c1ccccn1 |
| InChI | InChI=1S/C13H15N3O3S/c14-13-11(9-5-1-3-7-15-9)12(19-16-13)10-6-2-4-8-20(10,17)18/h1,3,5,7,10H,2,4,6,8H2,(H2,14,16) |
| InChIKey | ZYIRHCLQGQBQBU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |