C14H9Cl2N3O — CID 80521472
5-(3,5-dichlorophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine (PubChem CID 80521472) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(3,5-dichlorophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 80521472 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2cc(Cl)cc(Cl)c2)c1-c1ccccn1 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-9-5-8(6-10(16)7-9)13-12(14(17)19-20-13)11-3-1-2-4-18-11/h1-7H,(H2,17,19) |
| InChIKey | OADBRMUSLODULB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |